About (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol
(2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol (PubChem CID 163195082) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol |
| PubChem CID | 163195082 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol |
| SMILES | C[C@@H](CO)[C@H]1CC[C@@](C)([C@H]2CO2)O1 |
| InChI | InChI=1S/C10H18O3/c1-7(5-11)8-3-4-10(2,13-8)9-6-12-9/h7-9,11H,3-6H2,1-2H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | XZDUDSXRVQCEKT-JLIMGVALSA-N |
| XLogP | 0.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol?
The IUPAC name of (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol (CID 163195082) is (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol.
What is the SMILES notation for (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol?
The canonical SMILES for (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol is C[C@@H](CO)[C@H]1CC[C@@](C)([C@H]2CO2)O1.
What is the InChIKey of (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol?
The InChIKey is XZDUDSXRVQCEKT-JLIMGVALSA-N. The full InChI is InChI=1S/C10H18O3/c1-7(5-11)8-3-4-10(2,13-8)9-6-12-9/h7-9,11H,3-6H2,1-2H3/t7-,8+,9+,10-/m0/s1.
What are the key properties of (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol?
(2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol has a molecular weight of 186.25 g/mol, XLogP of 0.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2R,5S)-5-methyl-5-[(2R)-oxiran-2-yl]oxolan-2-yl]propan-1-ol is sourced from PubChem (CID 163195082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).