C30H44O5 — CID 163195347
(2R,6R)-6-[(1'S,2R,3aR,4S,5S)-4-(2-carboxyethyl)-1',4-dimethyl-3'-methylidene-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-1H-indene-2,2'-cyclopentane]-1'-yl]-2-methyl-4-oxoheptanoic acid (PubChem CID 163195347) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (2R,6R)-6-[(1'S,2R,3aR,4S,5S)-4-(2-carboxyethyl)-1',4-dimethyl-3'-methylidene-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-1H-indene-2,2'-cyclopentane]-1'-yl]-2-methyl-4-oxoheptanoic acid.
| Compound Name | (2R,6R)-6-[(1'S,2R,3aR,4S,5S)-4-(2-carboxyethyl)-1',4-dimethyl-3'-methylidene-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-1H-indene-2,2'-cyclopentane]-1'-yl]-2-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 163195347 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (2R,6R)-6-[(1'S,2R,3aR,4S,5S)-4-(2-carboxyethyl)-1',4-dimethyl-3'-methylidene-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-1H-indene-2,2'-cyclopentane]-1'-yl]-2-methyl-4-oxoheptanoic acid |
| SMILES | C=C(C)[C@@H]1CC=C2C[C@]3(C[C@H]2[C@@]1(C)CCC(=O)O)C(=C)CC[C@@]3(C)[C@H](C)CC(=O)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C30H44O5/c1-18(2)24-9-8-22-16-30(17-25(22)28(24,6)12-11-26(32)33)20(4)10-13-29(30,7)21(5)15-23(31)14-19(3)27(34)35/h8,19,21,24-25H,1,4,9-17H2,2-3,5-7H3,(H,32,33)(H,34,35)/t19-,21-,24+,25-,28+,29+,30+/m1/s1 |
| InChIKey | QDMMUVWIKPTNHN-GRDCQMQTSA-N |
| XLogP | 6.84 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|