C20H36O3 — CID 163195364
(3S,6E,10E,14S)-2,6,10,14-tetramethylhexadeca-6,10,15-triene-2,3,14-triol (PubChem CID 163195364) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (3S,6E,10E,14S)-2,6,10,14-tetramethylhexadeca-6,10,15-triene-2,3,14-triol.
| Compound Name | (3S,6E,10E,14S)-2,6,10,14-tetramethylhexadeca-6,10,15-triene-2,3,14-triol |
|---|---|
| PubChem CID | 163195364 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (3S,6E,10E,14S)-2,6,10,14-tetramethylhexadeca-6,10,15-triene-2,3,14-triol |
| SMILES | C=C[C@@](C)(O)CC/C=C(\C)CC/C=C(\C)CC[C@H](O)C(C)(C)O |
| InChI | InChI=1S/C20H36O3/c1-7-20(6,23)15-9-12-16(2)10-8-11-17(3)13-14-18(21)19(4,5)22/h7,11-12,18,21-23H,1,8-10,13-15H2,2-6H3/b16-12+,17-11+/t18-,20+/m0/s1 |
| InChIKey | PKUIPULYNWMNLR-GREXEMICSA-N |
| XLogP | 4.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|