C26H38N5O+ — CID 163195585
(4R,5S)-4-[(7E)-9-(6-amino-9-methylpurin-9-ium-7-yl)-3,7-dimethylnona-3,7-dienyl]-3,4,5-trimethylcyclohex-2-en-1-one (PubChem CID 163195585) has the molecular formula C26H38N5O+ and a molecular weight of 436.62 g/mol. Its IUPAC name is (4R,5S)-4-[(7E)-9-(6-amino-9-methylpurin-9-ium-7-yl)-3,7-dimethylnona-3,7-dienyl]-3,4,5-trimethylcyclohex-2-en-1-one.
| Compound Name | (4R,5S)-4-[(7E)-9-(6-amino-9-methylpurin-9-ium-7-yl)-3,7-dimethylnona-3,7-dienyl]-3,4,5-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163195585 |
| Molecular Formula | C26H38N5O+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | (4R,5S)-4-[(7E)-9-(6-amino-9-methylpurin-9-ium-7-yl)-3,7-dimethylnona-3,7-dienyl]-3,4,5-trimethylcyclohex-2-en-1-one |
| SMILES | CC(=CCC/C(C)=C/Cn1c[n+](C)c2ncnc(N)c21)CC[C@@]1(C)C(C)=CC(=O)C[C@@H]1C |
| InChI | InChI=1S/C26H38N5O/c1-18(10-12-26(5)20(3)14-22(32)15-21(26)4)8-7-9-19(2)11-13-31-17-30(6)25-23(31)24(27)28-16-29-25/h8,11,14,16-17,21H,7,9-10,12-13,15H2,1-6H3,(H2,27,28,29)/q+1/b18-8?,19-11+/t21-,26-/m0/s1 |
| InChIKey | VNHUAACDBKEOPD-GJPGMSPXSA-N |
| XLogP | 4.85 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|