C23H38O4 — CID 163195719
1,3-dimethoxy-7-methyl-10-(6-methylhept-5-en-2-yl)-1,3,5,8,9,10,11,11a-octahydrocyclodeca[c]furan-9-ol (PubChem CID 163195719) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 1,3-dimethoxy-7-methyl-10-(6-methylhept-5-en-2-yl)-1,3,5,8,9,10,11,11a-octahydrocyclodeca[c]furan-9-ol.
| Compound Name | 1,3-dimethoxy-7-methyl-10-(6-methylhept-5-en-2-yl)-1,3,5,8,9,10,11,11a-octahydrocyclodeca[c]furan-9-ol |
|---|---|
| PubChem CID | 163195719 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 1,3-dimethoxy-7-methyl-10-(6-methylhept-5-en-2-yl)-1,3,5,8,9,10,11,11a-octahydrocyclodeca[c]furan-9-ol |
| SMILES | COC1OC(OC)C2CC(C(C)CCC=C(C)C)C(O)CC(C)=CCC=C12 |
| InChI | InChI=1S/C23H38O4/c1-15(2)9-7-11-17(4)19-14-20-18(22(25-5)27-23(20)26-6)12-8-10-16(3)13-21(19)24/h9-10,12,17,19-24H,7-8,11,13-14H2,1-6H3 |
| InChIKey | CAZXVJBBZOEUTO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|