C23H19N5O8S — CID 163196776
ethyl 5-[(E)-(7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylidenehydrazinylidene]-4-(4-nitrophenyl)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 163196776) has the molecular formula C23H19N5O8S and a molecular weight of 525.50 g/mol. Its IUPAC name is ethyl 5-[(E)-(7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylidenehydrazinylidene]-4-(4-nitrophenyl)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | ethyl 5-[(E)-(7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylidenehydrazinylidene]-4-(4-nitrophenyl)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 163196776 |
| Molecular Formula | C23H19N5O8S |
| Molecular Weight | 525.50 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | ethyl 5-[(E)-(7-hydroxy-5-methoxy-2-methyl-4-oxochromen-6-yl)methylidenehydrazinylidene]-4-(4-nitrophenyl)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)c(=N/N=C/c2c(O)cc3oc(C)cc(=O)c3c2OC)s1 |
| InChI | InChI=1S/C23H19N5O8S/c1-4-35-22(31)21-26-27(13-5-7-14(8-6-13)28(32)33)23(37-21)25-24-11-15-16(29)10-18-19(20(15)34-3)17(30)9-12(2)36-18/h5-11,29H,4H2,1-3H3/b24-11+,25-23? |
| InChIKey | PMSHCSGUCIDDPV-CKDGDGCNSA-N |
| XLogP | 3.08 |
| TPSA | 171.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|