C22H22N4O2S — CID 163196781
(1S)-1-(1H-imidazol-5-ylmethyl)-2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 163196781) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is (1S)-1-(1H-imidazol-5-ylmethyl)-2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-1-(1H-imidazol-5-ylmethyl)-2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 163196781 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (1S)-1-(1H-imidazol-5-ylmethyl)-2-(4-methylphenyl)sulfonyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3c([nH]c4ccccc34)[C@@H]2Cc2cnc[nH]2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c1-15-6-8-17(9-7-15)29(27,28)26-11-10-19-18-4-2-3-5-20(18)25-22(19)21(26)12-16-13-23-14-24-16/h2-9,13-14,21,25H,10-12H2,1H3,(H,23,24)/t21-/m0/s1 |
| InChIKey | GRQDRVUGJCUAHR-NRFANRHFSA-N |
| XLogP | 3.73 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|