C35H50N2S — CID 163196814
(1S,2R,13S,14S,17R,18R)-N,2,18-trimethyl-17-[(2R)-6-methylheptan-2-yl]-N-phenyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine (PubChem CID 163196814) has the molecular formula C35H50N2S and a molecular weight of 530.87 g/mol. Its IUPAC name is (1S,2R,13S,14S,17R,18R)-N,2,18-trimethyl-17-[(2R)-6-methylheptan-2-yl]-N-phenyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine.
| Compound Name | (1S,2R,13S,14S,17R,18R)-N,2,18-trimethyl-17-[(2R)-6-methylheptan-2-yl]-N-phenyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
|---|---|
| PubChem CID | 163196814 |
| Molecular Formula | C35H50N2S |
| Molecular Weight | 530.87 g/mol |
| Exact Mass | 530.37 |
| IUPAC Name | (1S,2R,13S,14S,17R,18R)-N,2,18-trimethyl-17-[(2R)-6-methylheptan-2-yl]-N-phenyl-8-thia-6-azapentacyclo[11.7.0.02,10.05,9.014,18]icosa-5(9),6,10-trien-7-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4c5sc(N(C)c6ccccc6)nc5CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H50N2S/c1-23(2)11-10-12-24(3)27-17-18-28-26-15-16-30-32-31(20-22-35(30,5)29(26)19-21-34(27,28)4)36-33(38-32)37(6)25-13-8-7-9-14-25/h7-9,13-14,16,23-24,26-29H,10-12,15,17-22H2,1-6H3/t24-,26+,27-,28+,29+,34-,35-/m1/s1 |
| InChIKey | ZVULLPDCFOBWGI-HAAHTCAYSA-N |
| XLogP | 10.17 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.87 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |