C19H40O14P2 — CID 163196948
[(2R)-3-[[(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropyl] decanoate (PubChem CID 163196948) has the molecular formula C19H40O14P2 and a molecular weight of 554.46 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropyl] decanoate.
| Compound Name | [(2R)-3-[[(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropyl] decanoate |
|---|---|
| PubChem CID | 163196948 |
| Molecular Formula | C19H40O14P2 |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 554.19 |
| IUPAC Name | [(2R)-3-[[(2S)-3-[[(2R)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-hydroxypropyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@@H](O)COP(=O)(O)OC[C@@H](O)COP(=O)(O)OC[C@H](O)CO |
| InChI | InChI=1S/C19H40O14P2/c1-2-3-4-5-6-7-8-9-19(24)29-11-17(22)13-31-35(27,28)33-15-18(23)14-32-34(25,26)30-12-16(21)10-20/h16-18,20-23H,2-15H2,1H3,(H,25,26)(H,27,28)/t16-,17-,18+/m1/s1 |
| InChIKey | HGKXJEJTYQBLOP-KURKYZTESA-N |
| XLogP | 1.01 |
| TPSA | 218.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|