C25H26N4OS — CID 163197060
3-(2-ethyl-5-thiophen-2-yltriazol-4-yl)-N-(4-phenylbutyl)benzamide (PubChem CID 163197060) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is 3-(2-ethyl-5-thiophen-2-yltriazol-4-yl)-N-(4-phenylbutyl)benzamide.
| Compound Name | 3-(2-ethyl-5-thiophen-2-yltriazol-4-yl)-N-(4-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 163197060 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 3-(2-ethyl-5-thiophen-2-yltriazol-4-yl)-N-(4-phenylbutyl)benzamide |
| SMILES | CCn1nc(-c2cccc(C(=O)NCCCCc3ccccc3)c2)c(-c2cccs2)n1 |
| InChI | InChI=1S/C25H26N4OS/c1-2-29-27-23(24(28-29)22-15-9-17-31-22)20-13-8-14-21(18-20)25(30)26-16-7-6-12-19-10-4-3-5-11-19/h3-5,8-11,13-15,17-18H,2,6-7,12,16H2,1H3,(H,26,30) |
| InChIKey | JDKISJXKBOHTOJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|