C42H27N3O3 — CID 163197808
5-[4-[3,5-bis[4-(6-formyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-2-carbaldehyde (PubChem CID 163197808) has the molecular formula C42H27N3O3 and a molecular weight of 621.70 g/mol. Its IUPAC name is 5-[4-[3,5-bis[4-(6-formyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-2-carbaldehyde.
| Compound Name | 5-[4-[3,5-bis[4-(6-formyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 163197808 |
| Molecular Formula | C42H27N3O3 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.21 |
| IUPAC Name | 5-[4-[3,5-bis[4-(6-formyl-3-pyridinyl)phenyl]phenyl]phenyl]pyridine-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccc(C=O)nc5)cc4)cc(-c4ccc(-c5ccc(C=O)nc5)cc4)c3)cc2)cn1 |
| InChI | InChI=1S/C42H27N3O3/c46-25-40-16-13-34(22-43-40)28-1-7-31(8-2-28)37-19-38(32-9-3-29(4-10-32)35-14-17-41(26-47)44-23-35)21-39(20-37)33-11-5-30(6-12-33)36-15-18-42(27-48)45-24-36/h1-27H |
| InChIKey | ZAKRXUYLUMQKGR-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|