About 3-methoxythieno[3,4-b]pyridine-5,7-diamine
3-methoxythieno[3,4-b]pyridine-5,7-diamine (PubChem CID 163198649) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-methoxythieno[3,4-b]pyridine-5,7-diamine.
Molecular Properties
| Compound Name | 3-methoxythieno[3,4-b]pyridine-5,7-diamine |
| PubChem CID | 163198649 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-methoxythieno[3,4-b]pyridine-5,7-diamine |
| SMILES | COc1cnc2c(N)sc(N)c2c1 |
| InChI | InChI=1S/C8H9N3OS/c1-12-4-2-5-6(11-3-4)8(10)13-7(5)9/h2-3H,9-10H2,1H3 |
| InChIKey | PHBZTRYXLZVHDF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxythieno[3,4-b]pyridine-5,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxythieno[3,4-b]pyridine-5,7-diamine?
The IUPAC name of 3-methoxythieno[3,4-b]pyridine-5,7-diamine (CID 163198649) is 3-methoxythieno[3,4-b]pyridine-5,7-diamine.
What is the SMILES notation for 3-methoxythieno[3,4-b]pyridine-5,7-diamine?
The canonical SMILES for 3-methoxythieno[3,4-b]pyridine-5,7-diamine is COc1cnc2c(N)sc(N)c2c1.
What is the InChIKey of 3-methoxythieno[3,4-b]pyridine-5,7-diamine?
The InChIKey is PHBZTRYXLZVHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-12-4-2-5-6(11-3-4)8(10)13-7(5)9/h2-3H,9-10H2,1H3.
What are the key properties of 3-methoxythieno[3,4-b]pyridine-5,7-diamine?
3-methoxythieno[3,4-b]pyridine-5,7-diamine has a molecular weight of 195.25 g/mol, XLogP of 1.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxythieno[3,4-b]pyridine-5,7-diamine is sourced from PubChem (CID 163198649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).