C15H19F2NO3 — CID 163198765
tert-butyl (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoate (PubChem CID 163198765) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 163198765 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl (2R)-2-[[2-(3,5-difluorophenyl)acetyl]amino]propanoate |
| SMILES | C[C@@H](NC(=O)Cc1cc(F)cc(F)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H19F2NO3/c1-9(14(20)21-15(2,3)4)18-13(19)7-10-5-11(16)8-12(17)6-10/h5-6,8-9H,7H2,1-4H3,(H,18,19)/t9-/m1/s1 |
| InChIKey | PHTBKBJNFOOBCM-SECBINFHSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |