About 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine
2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine (PubChem CID 163198836) has the molecular formula C36H26N8
and a molecular weight of 570.66 g/mol. Its IUPAC name is 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine |
| PubChem CID | 163198836 |
| Molecular Formula | C36H26N8 |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.23 |
| IUPAC Name | 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine |
| SMILES | Cc1ncc(-c2cc(-c3cnc(C)nc3)c3ccc4c(-c5cnc(C)nc5)cc(-c5cnc(C)nc5)c5ccc2c3c54)cn1 |
| InChI | InChI=1S/C36H26N8/c1-19-37-11-23(12-38-19)31-9-32(24-13-39-20(2)40-14-24)28-7-8-30-34(26-17-43-22(4)44-18-26)10-33(25-15-41-21(3)42-16-25)29-6-5-27(31)35(28)36(29)30/h5-18H,1-4H3 |
| InChIKey | ZOVQBVBTHZNREH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine?
The IUPAC name of 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine (CID 163198836) is 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine.
What is the SMILES notation for 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine?
The canonical SMILES for 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine is Cc1ncc(-c2cc(-c3cnc(C)nc3)c3ccc4c(-c5cnc(C)nc5)cc(-c5cnc(C)nc5)c5ccc2c3c54)cn1.
What is the InChIKey of 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine?
The InChIKey is ZOVQBVBTHZNREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26N8/c1-19-37-11-23(12-38-19)31-9-32(24-13-39-20(2)40-14-24)28-7-8-30-34(26-17-43-22(4)44-18-26)10-33(25-15-41-21(3)42-16-25)29-6-5-27(31)35(28)36(29)30/h5-18H,1-4H3.
What are the key properties of 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine?
2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine has a molecular weight of 570.66 g/mol, XLogP of 7.65, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-[3,6,8-tris(2-methylpyrimidin-5-yl)pyren-1-yl]pyrimidine is sourced from PubChem (CID 163198836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).