C15H14BF3KNO2 — CID 163199251
potassium trifluoro-[2-methyl-4-(phenylmethoxycarbonylamino)phenyl]boranuide (PubChem CID 163199251) has the molecular formula C15H14BF3KNO2 and a molecular weight of 347.19 g/mol. Its IUPAC name is potassium trifluoro-[2-methyl-4-(phenylmethoxycarbonylamino)phenyl]boranuide.
| Compound Name | potassium trifluoro-[2-methyl-4-(phenylmethoxycarbonylamino)phenyl]boranuide |
|---|---|
| PubChem CID | 163199251 |
| Molecular Formula | C15H14BF3KNO2 |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | potassium trifluoro-[2-methyl-4-(phenylmethoxycarbonylamino)phenyl]boranuide |
| SMILES | Cc1cc(NC(=O)OCc2ccccc2)ccc1[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C15H14BF3NO2.K/c1-11-9-13(7-8-14(11)16(17,18)19)20-15(21)22-10-12-5-3-2-4-6-12;/h2-9H,10H2,1H3,(H,20,21);/q-1;+1 |
| InChIKey | RUAOFFHTTXBCCU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|