C13H23N5O7 — CID 163199932
2-hydroxy-N-[6-hydroxy-9-(1,2,3,5-tetrahydroxypentyl)-1,4,5,6-tetrahydropurin-2-yl]propanamide (PubChem CID 163199932) has the molecular formula C13H23N5O7 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-hydroxy-N-[6-hydroxy-9-(1,2,3,5-tetrahydroxypentyl)-1,4,5,6-tetrahydropurin-2-yl]propanamide.
| Compound Name | 2-hydroxy-N-[6-hydroxy-9-(1,2,3,5-tetrahydroxypentyl)-1,4,5,6-tetrahydropurin-2-yl]propanamide |
|---|---|
| PubChem CID | 163199932 |
| Molecular Formula | C13H23N5O7 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-hydroxy-N-[6-hydroxy-9-(1,2,3,5-tetrahydroxypentyl)-1,4,5,6-tetrahydropurin-2-yl]propanamide |
| SMILES | CC(O)C(=O)NC1=NC2C(N=CN2C(O)C(O)C(O)CCO)C(O)N1 |
| InChI | InChI=1S/C13H23N5O7/c1-5(20)10(23)16-13-15-9-7(11(24)17-13)14-4-18(9)12(25)8(22)6(21)2-3-19/h4-9,11-12,19-22,24-25H,2-3H2,1H3,(H2,15,16,17,23) |
| InChIKey | NAUXCPSJAFUOHJ-UHFFFAOYSA-N |
| XLogP | -4.78 |
| TPSA | 190.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | -4.78 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |