C28H39N5O2 — CID 163200205
[(6R)-2-[[(4R)-2,2-dimethyloxan-4-yl]amino]-6-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-[(3S,4S)-1-methyl-3-phenylpiperidin-4-yl]methanone (PubChem CID 163200205) has the molecular formula C28H39N5O2 and a molecular weight of 477.65 g/mol. Its IUPAC name is [(6R)-2-[[(4R)-2,2-dimethyloxan-4-yl]amino]-6-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-[(3S,4S)-1-methyl-3-phenylpiperidin-4-yl]methanone.
| Compound Name | [(6R)-2-[[(4R)-2,2-dimethyloxan-4-yl]amino]-6-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-[(3S,4S)-1-methyl-3-phenylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 163200205 |
| Molecular Formula | C28H39N5O2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | [(6R)-2-[[(4R)-2,2-dimethyloxan-4-yl]amino]-6-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]-[(3S,4S)-1-methyl-3-phenylpiperidin-4-yl]methanone |
| SMILES | C[C@@H]1Cc2cnc(N[C@@H]3CCOC(C)(C)C3)nc2CN1C(=O)[C@H]1CCN(C)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H39N5O2/c1-19-14-21-16-29-27(30-22-11-13-35-28(2,3)15-22)31-25(21)18-33(19)26(34)23-10-12-32(4)17-24(23)20-8-6-5-7-9-20/h5-9,16,19,22-24H,10-15,17-18H2,1-4H3,(H,29,30,31)/t19-,22-,23+,24-/m1/s1 |
| InChIKey | IFQKMQCWXZVRMZ-OUJCMCIWSA-N |
| XLogP | 3.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |