C24H25F4N3O5S — CID 163200685
3,3-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)-2-oxo-1-[4-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]indole-5-carboxamide (PubChem CID 163200685) has the molecular formula C24H25F4N3O5S and a molecular weight of 543.54 g/mol. Its IUPAC name is 3,3-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)-2-oxo-1-[4-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]indole-5-carboxamide.
| Compound Name | 3,3-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)-2-oxo-1-[4-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 163200685 |
| Molecular Formula | C24H25F4N3O5S |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3,3-dimethyl-N-(4-methyl-1,1-dioxothian-4-yl)-2-oxo-1-[4-(1,1,2,2-tetrafluoroethoxy)-2-pyridinyl]indole-5-carboxamide |
| SMILES | CC1(NC(=O)c2ccc3c(c2)C(C)(C)C(=O)N3c2cc(OC(F)(F)C(F)F)ccn2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C24H25F4N3O5S/c1-22(2)16-12-14(19(32)30-23(3)7-10-37(34,35)11-8-23)4-5-17(16)31(21(22)33)18-13-15(6-9-29-18)36-24(27,28)20(25)26/h4-6,9,12-13,20H,7-8,10-11H2,1-3H3,(H,30,32) |
| InChIKey | SQWPBSVRABRDAI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|