C21H24ClN3O5S — CID 163200875
6-chloro-3-[[2,3-dioxo-4-(2-propan-2-ylanilino)cyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 163200875) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is 6-chloro-3-[[2,3-dioxo-4-(2-propan-2-ylanilino)cyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[2,3-dioxo-4-(2-propan-2-ylanilino)cyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 163200875 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | 6-chloro-3-[[2,3-dioxo-4-(2-propan-2-ylanilino)cyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CC(C)c1ccccc1NC1C(=O)C(=O)C1Nc1ccc(Cl)c(S(=O)(=O)N(C)C)c1O |
| InChI | InChI=1S/C21H24ClN3O5S/c1-11(2)12-7-5-6-8-14(12)23-16-17(20(28)19(16)27)24-15-10-9-13(22)21(18(15)26)31(29,30)25(3)4/h5-11,16-17,23-24,26H,1-4H3 |
| InChIKey | NTEMFBXITMTZJT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|