C18H22ClN3O5S — CID 163200897
6-chloro-3-[[2-[(1-cyclopropylcyclopropyl)amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 163200897) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is 6-chloro-3-[[2-[(1-cyclopropylcyclopropyl)amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 6-chloro-3-[[2-[(1-cyclopropylcyclopropyl)amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 163200897 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 6-chloro-3-[[2-[(1-cyclopropylcyclopropyl)amino]-3,4-dioxocyclobutyl]amino]-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(Cl)ccc(NC2C(=O)C(=O)C2NC2(C3CC3)CC2)c1O |
| InChI | InChI=1S/C18H22ClN3O5S/c1-22(2)28(26,27)17-10(19)5-6-11(14(17)23)20-12-13(16(25)15(12)24)21-18(7-8-18)9-3-4-9/h5-6,9,12-13,20-21,23H,3-4,7-8H2,1-2H3 |
| InChIKey | ASIXOLWSJRWNMD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|