C23H26ClN3O5S — CID 163200907
3-[[2-[(1-benzylcyclobutyl)amino]-3,4-dioxocyclobutyl]amino]-6-chloro-2-hydroxy-N,N-dimethylbenzenesulfonamide (PubChem CID 163200907) has the molecular formula C23H26ClN3O5S and a molecular weight of 492.00 g/mol. Its IUPAC name is 3-[[2-[(1-benzylcyclobutyl)amino]-3,4-dioxocyclobutyl]amino]-6-chloro-2-hydroxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 3-[[2-[(1-benzylcyclobutyl)amino]-3,4-dioxocyclobutyl]amino]-6-chloro-2-hydroxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 163200907 |
| Molecular Formula | C23H26ClN3O5S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 3-[[2-[(1-benzylcyclobutyl)amino]-3,4-dioxocyclobutyl]amino]-6-chloro-2-hydroxy-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1c(Cl)ccc(NC2C(=O)C(=O)C2NC2(Cc3ccccc3)CCC2)c1O |
| InChI | InChI=1S/C23H26ClN3O5S/c1-27(2)33(31,32)22-15(24)9-10-16(19(22)28)25-17-18(21(30)20(17)29)26-23(11-6-12-23)13-14-7-4-3-5-8-14/h3-5,7-10,17-18,25-26,28H,6,11-13H2,1-2H3 |
| InChIKey | GMPQONQJPZDRQB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|