C20H23F3N4O2 — CID 163200920
2-[6-[[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethoxy)phenol (PubChem CID 163200920) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2-[6-[[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethoxy)phenol.
| Compound Name | 2-[6-[[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 163200920 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 2-[6-[[(8R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]amino]pyridazin-3-yl]-3-methyl-5-(trifluoromethoxy)phenol |
| SMILES | Cc1cc(OC(F)(F)F)cc(O)c1-c1ccc(N[C@@H]2CCCN3CCC[C@H]23)nn1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-12-10-13(29-20(21,22)23)11-17(28)19(12)15-6-7-18(26-25-15)24-14-4-2-8-27-9-3-5-16(14)27/h6-7,10-11,14,16,28H,2-5,8-9H2,1H3,(H,24,26)/t14-,16-/m1/s1 |
| InChIKey | WIMFKJQIGRMTGO-GDBMZVCRSA-N |
| XLogP | 4.09 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |