C21H24ClN7O2 — CID 163200957
ethyl 1-[6-[(4-chloro-5-phenylpyrazolidin-3-yl)amino]pyrimidin-4-yl]-3,5-dimethylpyrazole-4-carboxylate (PubChem CID 163200957) has the molecular formula C21H24ClN7O2 and a molecular weight of 441.92 g/mol. Its IUPAC name is ethyl 1-[6-[(4-chloro-5-phenylpyrazolidin-3-yl)amino]pyrimidin-4-yl]-3,5-dimethylpyrazole-4-carboxylate.
| Compound Name | ethyl 1-[6-[(4-chloro-5-phenylpyrazolidin-3-yl)amino]pyrimidin-4-yl]-3,5-dimethylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 163200957 |
| Molecular Formula | C21H24ClN7O2 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | ethyl 1-[6-[(4-chloro-5-phenylpyrazolidin-3-yl)amino]pyrimidin-4-yl]-3,5-dimethylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(C)nn(-c2cc(NC3NNC(c4ccccc4)C3Cl)ncn2)c1C |
| InChI | InChI=1S/C21H24ClN7O2/c1-4-31-21(30)17-12(2)28-29(13(17)3)16-10-15(23-11-24-16)25-20-18(22)19(26-27-20)14-8-6-5-7-9-14/h5-11,18-20,26-27H,4H2,1-3H3,(H,23,24,25) |
| InChIKey | KNXXTQDPJXFPSO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|