C16H16N2 — CID 163201044
3,6-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1,3,7,9,11,13-hexaene (PubChem CID 163201044) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 3,6-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1,3,7,9,11,13-hexaene.
| Compound Name | 3,6-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1,3,7,9,11,13-hexaene |
|---|---|
| PubChem CID | 163201044 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3,6-diazatetracyclo[12.4.0.02,6.08,13]octadeca-1,3,7,9,11,13-hexaene |
| SMILES | C1=NC2=C3CCCCC3=c3ccccc3=CN2C1 |
| InChI | InChI=1S/C16H16N2/c1-2-6-13-12(5-1)11-18-10-9-17-16(18)15-8-4-3-7-14(13)15/h1-2,5-6,9,11H,3-4,7-8,10H2 |
| InChIKey | ZOXVJQVDMBEODU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |