C33H29N5O3 — CID 163201181
7-(5-hydroxy-9,10-dimethylbenzo[a]phenazin-6-yl)-1,3-dimethyl-5-phenyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 163201181) has the molecular formula C33H29N5O3 and a molecular weight of 543.63 g/mol. Its IUPAC name is 7-(5-hydroxy-9,10-dimethylbenzo[a]phenazin-6-yl)-1,3-dimethyl-5-phenyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 7-(5-hydroxy-9,10-dimethylbenzo[a]phenazin-6-yl)-1,3-dimethyl-5-phenyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 163201181 |
| Molecular Formula | C33H29N5O3 |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 7-(5-hydroxy-9,10-dimethylbenzo[a]phenazin-6-yl)-1,3-dimethyl-5-phenyl-5,6,7,8-tetrahydropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1cc2nc3c(C4CC(c5ccccc5)c5c(n(C)c(=O)n(C)c5=O)N4)c(O)c4ccccc4c3nc2cc1C |
| InChI | InChI=1S/C33H29N5O3/c1-17-14-23-24(15-18(17)2)35-29-27(30(39)21-13-9-8-12-20(21)28(29)34-23)25-16-22(19-10-6-5-7-11-19)26-31(36-25)37(3)33(41)38(4)32(26)40/h5-15,22,25,36,39H,16H2,1-4H3 |
| InChIKey | WWKXQMKWNOQUMH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|