C36H72O — CID 163201250
(E,6S,10R,15R,19R,23R)-27-methoxy-2,6,10,15,19,23,27-heptamethyloctacos-8-ene (PubChem CID 163201250) has the molecular formula C36H72O and a molecular weight of 520.97 g/mol. Its IUPAC name is (E,6S,10R,15R,19R,23R)-27-methoxy-2,6,10,15,19,23,27-heptamethyloctacos-8-ene.
| Compound Name | (E,6S,10R,15R,19R,23R)-27-methoxy-2,6,10,15,19,23,27-heptamethyloctacos-8-ene |
|---|---|
| PubChem CID | 163201250 |
| Molecular Formula | C36H72O |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.56 |
| IUPAC Name | (E,6S,10R,15R,19R,23R)-27-methoxy-2,6,10,15,19,23,27-heptamethyloctacos-8-ene |
| SMILES | COC(C)(C)CCC[C@H](C)CCC[C@H](C)CCC[C@H](C)CCCC[C@@H](C)/C=C/C[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C36H72O/c1-30(2)18-13-21-33(5)24-14-22-31(3)19-11-12-20-32(4)23-15-25-34(6)26-16-27-35(7)28-17-29-36(8,9)37-10/h14,22,30-35H,11-13,15-21,23-29H2,1-10H3/b22-14+/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | MFNCDJRFVWRQJI-SSWGJZQCSA-N |
| XLogP | 12.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|