C41H76O — CID 163201263
(6R,8E,10R,12E,14S,16E,19R,20E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-8,12,16,20-tetraene (PubChem CID 163201263) has the molecular formula C41H76O and a molecular weight of 585.06 g/mol. Its IUPAC name is (6R,8E,10R,12E,14S,16E,19R,20E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-8,12,16,20-tetraene.
| Compound Name | (6R,8E,10R,12E,14S,16E,19R,20E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-8,12,16,20-tetraene |
|---|---|
| PubChem CID | 163201263 |
| Molecular Formula | C41H76O |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.59 |
| IUPAC Name | (6R,8E,10R,12E,14S,16E,19R,20E,23S,27S)-2-methoxy-2,6,10,14,19,23,27,31-octamethyldotriaconta-8,12,16,20-tetraene |
| SMILES | COC(C)(C)CCC[C@@H](C)C/C=C/[C@H](C)C/C=C/[C@@H](C)C/C=C/C[C@@H](C)/C=C/C[C@@H](C)CCC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C41H76O/c1-34(2)20-14-23-37(5)26-17-29-38(6)27-15-24-35(3)21-12-13-22-36(4)25-16-28-39(7)30-18-31-40(8)32-19-33-41(9,10)42-11/h12-13,15-16,18,24-25,30,34-40H,14,17,19-23,26-29,31-33H2,1-11H3/b13-12+,24-15+,25-16+,30-18+/t35-,36+,37+,38-,39-,40+/m1/s1 |
| InChIKey | GJPNLBTYZJTAPC-GMTNPYETSA-N |
| XLogP | 13.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 13.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|