C14H23BN2O2S — CID 163201414
2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine (PubChem CID 163201414) has the molecular formula C14H23BN2O2S and a molecular weight of 294.23 g/mol. Its IUPAC name is 2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine.
| Compound Name | 2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 163201414 |
| Molecular Formula | C14H23BN2O2S |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-butylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine |
| SMILES | CCCCSc1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H23BN2O2S/c1-6-7-8-20-12-16-9-11(10-17-12)15-18-13(2,3)14(4,5)19-15/h9-10H,6-8H2,1-5H3 |
| InChIKey | WLQSDNPTGRKHLO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|