About dehydroxy-TFHFESE
dehydroxy-TFHFESE (PubChem CID 163201608) has the molecular formula C7H5F10OS
and a molecular weight of 327.16 g/mol.
Molecular Properties
| Compound Name | dehydroxy-TFHFESE |
| PubChem CID | 163201608 |
| Molecular Formula | C7H5F10OS |
| Molecular Weight | 327.16 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | — |
| SMILES | [CH2]CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F10OS/c1-2-19-4(9,10)3(8)18-7(16,17)5(11,12)6(13,14)15/h3H,1-2H2 |
| InChIKey | PUJWVXUDMXVDKW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|
Analyze dehydroxy-TFHFESE with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dehydroxy-TFHFESE?
The IUPAC name of dehydroxy-TFHFESE (CID 163201608) is not available.
What is the SMILES notation for dehydroxy-TFHFESE?
The canonical SMILES for dehydroxy-TFHFESE is [CH2]CSC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F.
What is the InChIKey of dehydroxy-TFHFESE?
The InChIKey is PUJWVXUDMXVDKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F10OS/c1-2-19-4(9,10)3(8)18-7(16,17)5(11,12)6(13,14)15/h3H,1-2H2.
What are the key properties of dehydroxy-TFHFESE?
dehydroxy-TFHFESE has a molecular weight of 327.16 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dehydroxy-TFHFESE is sourced from PubChem (CID 163201608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).