C32H25BrClF3N6O4 — CID 163201672
4-[12-(4-bromo-3-chlorobenzoyl)-8-oxo-5-[[4-(trifluoromethoxy)phenyl]methylamino]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide (PubChem CID 163201672) has the molecular formula C32H25BrClF3N6O4 and a molecular weight of 729.94 g/mol. Its IUPAC name is 4-[12-(4-bromo-3-chlorobenzoyl)-8-oxo-5-[[4-(trifluoromethoxy)phenyl]methylamino]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide.
| Compound Name | 4-[12-(4-bromo-3-chlorobenzoyl)-8-oxo-5-[[4-(trifluoromethoxy)phenyl]methylamino]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 163201672 |
| Molecular Formula | C32H25BrClF3N6O4 |
| Molecular Weight | 729.94 g/mol |
| Exact Mass | 728.08 |
| IUPAC Name | 4-[12-(4-bromo-3-chlorobenzoyl)-8-oxo-5-[[4-(trifluoromethoxy)phenyl]methylamino]-2,3,7,12-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5-trien-7-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(-n2c(=O)c3c(n4ncc(NCc5ccc(OC(F)(F)F)cc5)c24)CN(C(=O)c2ccc(Br)c(Cl)c2)CC3)cc1 |
| InChI | InChI=1S/C32H25BrClF3N6O4/c1-38-28(44)19-4-7-21(8-5-19)42-29-26(39-15-18-2-9-22(10-3-18)47-32(35,36)37)16-40-43(29)27-17-41(13-12-23(27)31(42)46)30(45)20-6-11-24(33)25(34)14-20/h2-11,14,16,39H,12-13,15,17H2,1H3,(H,38,44) |
| InChIKey | GCEJFWISHXSABU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 109.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |