C24H16F3N3O2 — CID 163201781
N-[[2-[4-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]methyl]quinazolin-4-amine (PubChem CID 163201781) has the molecular formula C24H16F3N3O2 and a molecular weight of 435.41 g/mol. Its IUPAC name is N-[[2-[4-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]methyl]quinazolin-4-amine.
| Compound Name | N-[[2-[4-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 163201781 |
| Molecular Formula | C24H16F3N3O2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | N-[[2-[4-(trifluoromethoxy)phenyl]-1-benzofuran-5-yl]methyl]quinazolin-4-amine |
| SMILES | FC(F)(F)Oc1ccc(-c2cc3cc(CNc4ncnc5ccccc45)ccc3o2)cc1 |
| InChI | InChI=1S/C24H16F3N3O2/c25-24(26,27)32-18-8-6-16(7-9-18)22-12-17-11-15(5-10-21(17)31-22)13-28-23-19-3-1-2-4-20(19)29-14-30-23/h1-12,14H,13H2,(H,28,29,30) |
| InChIKey | TYTNHIGZJIEGNH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |