C25H23FN4O — CID 163201876
4-(4-fluorophenyl)-1-[4-(quinazolin-4-ylamino)phenyl]piperidin-4-ol (PubChem CID 163201876) has the molecular formula C25H23FN4O and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[4-(quinazolin-4-ylamino)phenyl]piperidin-4-ol.
| Compound Name | 4-(4-fluorophenyl)-1-[4-(quinazolin-4-ylamino)phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 163201876 |
| Molecular Formula | C25H23FN4O |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[4-(quinazolin-4-ylamino)phenyl]piperidin-4-ol |
| SMILES | OC1(c2ccc(F)cc2)CCN(c2ccc(Nc3ncnc4ccccc34)cc2)CC1 |
| InChI | InChI=1S/C25H23FN4O/c26-19-7-5-18(6-8-19)25(31)13-15-30(16-14-25)21-11-9-20(10-12-21)29-24-22-3-1-2-4-23(22)27-17-28-24/h1-12,17,31H,13-16H2,(H,27,28,29) |
| InChIKey | FXCFFRQCHNTUIX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|