C16H25N3O2SSi — CID 163202171
N-(1,1-dimethylsilocan-5-yl)-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 163202171) has the molecular formula C16H25N3O2SSi and a molecular weight of 351.55 g/mol. Its IUPAC name is N-(1,1-dimethylsilocan-5-yl)-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | N-(1,1-dimethylsilocan-5-yl)-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 163202171 |
| Molecular Formula | C16H25N3O2SSi |
| Molecular Weight | 351.55 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-(1,1-dimethylsilocan-5-yl)-2-methoxy-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | COc1nc2[nH]c(C(=O)NC3CCC[Si](C)(C)CCC3)cc2s1 |
| InChI | InChI=1S/C16H25N3O2SSi/c1-21-16-19-14-13(22-16)10-12(18-14)15(20)17-11-6-4-8-23(2,3)9-5-7-11/h10-11,18H,4-9H2,1-3H3,(H,17,20) |
| InChIKey | VUGSPTQJSDKBFF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|