About N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine
N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine (PubChem CID 163202306) has the molecular formula C19H13F3N4OS
and a molecular weight of 402.40 g/mol. Its IUPAC name is N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
| PubChem CID | 163202306 |
| Molecular Formula | C19H13F3N4OS |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cccc(Oc2ccc(CNc3ncnc4ccsc34)cn2)c1 |
| InChI | InChI=1S/C19H13F3N4OS/c20-19(21,22)13-2-1-3-14(8-13)27-16-5-4-12(9-23-16)10-24-18-17-15(6-7-28-17)25-11-26-18/h1-9,11H,10H2,(H,24,25,26) |
| InChIKey | XCZKCOQFWDLWKO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine?
The IUPAC name of N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine (CID 163202306) is N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine?
The canonical SMILES for N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine is FC(F)(F)c1cccc(Oc2ccc(CNc3ncnc4ccsc34)cn2)c1.
What is the InChIKey of N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine?
The InChIKey is XCZKCOQFWDLWKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13F3N4OS/c20-19(21,22)13-2-1-3-14(8-13)27-16-5-4-12(9-23-16)10-24-18-17-15(6-7-28-17)25-11-26-18/h1-9,11H,10H2,(H,24,25,26).
What are the key properties of N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine?
N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine has a molecular weight of 402.40 g/mol, XLogP of 5.51, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-[3-(trifluoromethyl)phenoxy]-3-pyridinyl]methyl]thieno[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 163202306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).