C18H27N3OSSi — CID 163202354
2-cyclopropyl-N-(1,1-dimethylsilocan-5-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 163202354) has the molecular formula C18H27N3OSSi and a molecular weight of 361.59 g/mol. Its IUPAC name is 2-cyclopropyl-N-(1,1-dimethylsilocan-5-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 2-cyclopropyl-N-(1,1-dimethylsilocan-5-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 163202354 |
| Molecular Formula | C18H27N3OSSi |
| Molecular Weight | 361.59 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-cyclopropyl-N-(1,1-dimethylsilocan-5-yl)-4H-pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | C[Si]1(C)CCCC(NC(=O)c2cc3sc(C4CC4)nc3[nH]2)CCC1 |
| InChI | InChI=1S/C18H27N3OSSi/c1-24(2)9-3-5-13(6-4-10-24)19-17(22)14-11-15-16(20-14)21-18(23-15)12-7-8-12/h11-13,20H,3-10H2,1-2H3,(H,19,22) |
| InChIKey | FOMDFNBWXQKMEJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|