C16H21N3O4S — CID 163202805
4-ethyl-3-methyl-5-oxo-N-[2-(2-sulfamoylphenyl)ethyl]-2H-pyrrole-1-carboxamide (PubChem CID 163202805) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is 4-ethyl-3-methyl-5-oxo-N-[2-(2-sulfamoylphenyl)ethyl]-2H-pyrrole-1-carboxamide.
| Compound Name | 4-ethyl-3-methyl-5-oxo-N-[2-(2-sulfamoylphenyl)ethyl]-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 163202805 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-ethyl-3-methyl-5-oxo-N-[2-(2-sulfamoylphenyl)ethyl]-2H-pyrrole-1-carboxamide |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccccc2S(N)(=O)=O)C1=O |
| InChI | InChI=1S/C16H21N3O4S/c1-3-13-11(2)10-19(15(13)20)16(21)18-9-8-12-6-4-5-7-14(12)24(17,22)23/h4-7H,3,8-10H2,1-2H3,(H,18,21)(H2,17,22,23) |
| InChIKey | GHWBVDLMSQNGFO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |