About 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate
1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate (PubChem CID 163202979) has the molecular formula C16H20NO5-
and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate |
| PubChem CID | 163202979 |
| Molecular Formula | C16H20NO5- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate |
| SMILES | CCC1(C(=O)[O-])CCC(O)C[N+]1(Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C16H21NO5/c1-2-16(14(19)20)9-8-13(18)11-17(16,15(21)22)10-12-6-4-3-5-7-12/h3-7,13,18H,2,8-11H2,1H3,(H-,19,20,21,22)/p-1 |
| InChIKey | YUEDQYPEALUHEX-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate?
The IUPAC name of 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate (CID 163202979) is 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate.
What is the SMILES notation for 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate?
The canonical SMILES for 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate is CCC1(C(=O)[O-])CCC(O)C[N+]1(Cc1ccccc1)C(=O)[O-].
What is the InChIKey of 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate?
The InChIKey is YUEDQYPEALUHEX-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H21NO5/c1-2-16(14(19)20)9-8-13(18)11-17(16,15(21)22)10-12-6-4-3-5-7-12/h3-7,13,18H,2,8-11H2,1H3,(H-,19,20,21,22)/p-1.
What are the key properties of 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate?
1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate has a molecular weight of 306.34 g/mol, XLogP of -0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-ethyl-5-hydroxypiperidin-1-ium-1,2-dicarboxylate is sourced from PubChem (CID 163202979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).