C17H16N3O2S+ — CID 163203319
4,13-dimethoxy-12,14-dimethyl-1,8-diaza-10-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8,10(15),11,13-heptaene-16-thione (PubChem CID 163203319) has the molecular formula C17H16N3O2S+ and a molecular weight of 326.40 g/mol. Its IUPAC name is 4,13-dimethoxy-12,14-dimethyl-1,8-diaza-10-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8,10(15),11,13-heptaene-16-thione.
| Compound Name | 4,13-dimethoxy-12,14-dimethyl-1,8-diaza-10-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8,10(15),11,13-heptaene-16-thione |
|---|---|
| PubChem CID | 163203319 |
| Molecular Formula | C17H16N3O2S+ |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4,13-dimethoxy-12,14-dimethyl-1,8-diaza-10-azoniatetracyclo[7.7.0.02,7.010,15]hexadeca-2(7),3,5,8,10(15),11,13-heptaene-16-thione |
| SMILES | COc1ccc2nc3n(c2c1)C(=S)c1c(C)c(OC)c(C)c[n+]1-3 |
| InChI | InChI=1S/C17H16N3O2S/c1-9-8-19-14(10(2)15(9)22-4)16(23)20-13-7-11(21-3)5-6-12(13)18-17(19)20/h5-8H,1-4H3/q+1 |
| InChIKey | PQFUAWCLLUWVTJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|