About 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile
3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile (PubChem CID 163203444) has the molecular formula C15H14N2O2S
and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile.
Molecular Properties
| Compound Name | 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile |
| PubChem CID | 163203444 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile |
| SMILES | Cc1cnc(-c2cc(C#N)cc(O[C@H]3CCOC3)c2)s1 |
| InChI | InChI=1S/C15H14N2O2S/c1-10-8-17-15(20-10)12-4-11(7-16)5-14(6-12)19-13-2-3-18-9-13/h4-6,8,13H,2-3,9H2,1H3/t13-/m0/s1 |
| InChIKey | DPLUVZSKWHLDAH-ZDUSSCGKSA-N |
| XLogP | 3.16 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile?
The IUPAC name of 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile (CID 163203444) is 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile.
What is the SMILES notation for 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile?
The canonical SMILES for 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile is Cc1cnc(-c2cc(C#N)cc(O[C@H]3CCOC3)c2)s1.
What is the InChIKey of 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile?
The InChIKey is DPLUVZSKWHLDAH-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H14N2O2S/c1-10-8-17-15(20-10)12-4-11(7-16)5-14(6-12)19-13-2-3-18-9-13/h4-6,8,13H,2-3,9H2,1H3/t13-/m0/s1.
What are the key properties of 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile?
3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile has a molecular weight of 286.36 g/mol, XLogP of 3.16, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-1,3-thiazol-2-yl)-5-[(3S)-oxolan-3-yl]oxybenzonitrile is sourced from PubChem (CID 163203444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).