C20H30O7 — CID 163203587
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,6R)-3-hydroxy-4-methyl-6-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphthalen-2-yl]oxy]oxane-3,4,5-triol (PubChem CID 163203587) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,6R)-3-hydroxy-4-methyl-6-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphthalen-2-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,6R)-3-hydroxy-4-methyl-6-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphthalen-2-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163203587 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[(2R,3R,4S,6R)-3-hydroxy-4-methyl-6-prop-1-en-2-yl-2,3,4,6,7,8-hexahydronaphthalen-2-yl]oxy]oxane-3,4,5-triol |
| SMILES | C=C(C)[C@H]1C=C2C(=C[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2C)CC1 |
| InChI | InChI=1S/C20H30O7/c1-9(2)11-4-5-12-7-14(16(22)10(3)13(12)6-11)26-20-19(25)18(24)17(23)15(8-21)27-20/h6-7,10-11,14-25H,1,4-5,8H2,2-3H3/t10-,11+,14+,15+,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | IGTDRTJURKLVPF-GXGCKDLESA-N |
| XLogP | 0.02 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|