About 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde
5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde (PubChem CID 163203718) has the molecular formula C40H22N4O4
and a molecular weight of 622.64 g/mol. Its IUPAC name is 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde |
| PubChem CID | 163203718 |
| Molecular Formula | C40H22N4O4 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cc(-c3ccc(C=O)nc3)c3ccc4c(-c5ccc(C=O)nc5)cc(-c5ccc(C=O)nc5)c5ccc2c3c54)cn1 |
| InChI | InChI=1S/C40H22N4O4/c45-19-27-5-1-23(15-41-27)35-13-36(24-2-6-28(20-46)42-16-24)32-11-12-34-38(26-4-8-30(22-48)44-18-26)14-37(25-3-7-29(21-47)43-17-25)33-10-9-31(35)39(32)40(33)34/h1-22H |
| InChIKey | LGUSGVMWDCICQM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 119.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde?
The IUPAC name of 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde (CID 163203718) is 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde.
What is the SMILES notation for 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde?
The canonical SMILES for 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde is O=Cc1ccc(-c2cc(-c3ccc(C=O)nc3)c3ccc4c(-c5ccc(C=O)nc5)cc(-c5ccc(C=O)nc5)c5ccc2c3c54)cn1.
What is the InChIKey of 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde?
The InChIKey is LGUSGVMWDCICQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H22N4O4/c45-19-27-5-1-23(15-41-27)35-13-36(24-2-6-28(20-46)42-16-24)32-11-12-34-38(26-4-8-30(22-48)44-18-26)14-37(25-3-7-29(21-47)43-17-25)33-10-9-31(35)39(32)40(33)34/h1-22H.
What are the key properties of 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde?
5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde has a molecular weight of 622.64 g/mol, XLogP of 8.08, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,6,8-tris(6-formyl-3-pyridinyl)pyren-1-yl]pyridine-2-carbaldehyde is sourced from PubChem (CID 163203718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).