C19H16O12 — CID 163203838
7,14-dihydroxy-6-(2-hydroxyethoxy)-13-(2,3,3-trihydroxypropoxy)-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione (PubChem CID 163203838) has the molecular formula C19H16O12 and a molecular weight of 436.33 g/mol. Its IUPAC name is 7,14-dihydroxy-6-(2-hydroxyethoxy)-13-(2,3,3-trihydroxypropoxy)-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione.
| Compound Name | 7,14-dihydroxy-6-(2-hydroxyethoxy)-13-(2,3,3-trihydroxypropoxy)-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
|---|---|
| PubChem CID | 163203838 |
| Molecular Formula | C19H16O12 |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | 7,14-dihydroxy-6-(2-hydroxyethoxy)-13-(2,3,3-trihydroxypropoxy)-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaene-3,10-dione |
| SMILES | O=c1oc2c(O)c(OCC(O)C(O)O)cc3c(=O)oc4c(O)c(OCCO)cc1c4c23 |
| InChI | InChI=1S/C19H16O12/c20-1-2-28-9-3-6-11-12-7(19(27)30-15(11)13(9)22)4-10(29-5-8(21)17(24)25)14(23)16(12)31-18(6)26/h3-4,8,17,20-25H,1-2,5H2 |
| InChIKey | XNJDGQGCYPUCHP-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 200.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|