C8H8Ca — CID 163204054
calcium (3Z,5Z)-octa-1,3,5,7-tetraene (PubChem CID 163204054) has the molecular formula C8H8Ca and a molecular weight of 144.23 g/mol. Its IUPAC name is calcium (3Z,5Z)-octa-1,3,5,7-tetraene.
| Compound Name | calcium (3Z,5Z)-octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 163204054 |
| Molecular Formula | C8H8Ca |
| Molecular Weight | 144.23 g/mol |
| Exact Mass | 144.03 |
| IUPAC Name | calcium (3Z,5Z)-octa-1,3,5,7-tetraene |
| SMILES | [Ca+2].[H]/[C-]=C/C=C\C=C/C=[C-]/[H] |
| InChI | InChI=1S/C8H8.Ca/c1-3-5-7-8-6-4-2;/h1-8H;/q-2;+2/b7-5-,8-6-; |
| InChIKey | PSLIHUKBIOWIFB-OVDGFJEXSA-N |
| XLogP | 1.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|