C30H32FN5O4 — CID 163204409
(3S)-3-[5-[[(S)-[(1S,2S)-2-(aminomethyl)cyclopropyl]-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]methyl]amino]-6-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 163204409) has the molecular formula C30H32FN5O4 and a molecular weight of 545.62 g/mol. Its IUPAC name is (3S)-3-[5-[[(S)-[(1S,2S)-2-(aminomethyl)cyclopropyl]-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]methyl]amino]-6-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[5-[[(S)-[(1S,2S)-2-(aminomethyl)cyclopropyl]-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]methyl]amino]-6-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 163204409 |
| Molecular Formula | C30H32FN5O4 |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (3S)-3-[5-[[(S)-[(1S,2S)-2-(aminomethyl)cyclopropyl]-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]methyl]amino]-6-fluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1[C@@H](Nc1cc2c(cc1F)CN([C@H]1CCC(=O)NC1=O)C2=O)[C@H]1C[C@@H]1CN |
| InChI | InChI=1S/C30H32FN5O4/c1-14-4-5-17(27-15(2)35-40-16(27)3)8-20(14)28(21-9-18(21)12-32)33-24-11-22-19(10-23(24)31)13-36(30(22)39)25-6-7-26(37)34-29(25)38/h4-5,8,10-11,18,21,25,28,33H,6-7,9,12-13,32H2,1-3H3,(H,34,37,38)/t18-,21+,25+,28-/m1/s1 |
| InChIKey | XMBOGFWLJURGME-UTXWZIEWSA-N |
| XLogP | 3.91 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|