C12H13FO6S — CID 163204538
2-[(3S)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]ethanesulfonic acid (PubChem CID 163204538) has the molecular formula C12H13FO6S and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[(3S)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]ethanesulfonic acid.
| Compound Name | 2-[(3S)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 163204538 |
| Molecular Formula | C12H13FO6S |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 2-[(3S)-5-acetyl-7-fluoro-2,3-dihydro-1,4-benzodioxin-3-yl]ethanesulfonic acid |
| SMILES | CC(=O)c1cc(F)cc2c1O[C@@H](CCS(=O)(=O)O)CO2 |
| InChI | InChI=1S/C12H13FO6S/c1-7(14)10-4-8(13)5-11-12(10)19-9(6-18-11)2-3-20(15,16)17/h4-5,9H,2-3,6H2,1H3,(H,15,16,17)/t9-/m0/s1 |
| InChIKey | NQWHIYMGNTXRET-VIFPVBQESA-N |
| XLogP | 1.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|