About magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide
magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide (PubChem CID 163204937) has the molecular formula C12H23IMgO2
and a molecular weight of 350.52 g/mol. Its IUPAC name is magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide.
Molecular Properties
| Compound Name | magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide |
| PubChem CID | 163204937 |
| Molecular Formula | C12H23IMgO2 |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide |
| SMILES | [CH2-]C/C=C\CCOCOCCCCC.[I-].[Mg+2] |
| InChI | InChI=1S/C12H23O2.HI.Mg/c1-3-5-7-9-11-14-12-13-10-8-6-4-2;;/h5,7H,1,3-4,6,8-12H2,2H3;1H;/q-1;;+2/p-1/b7-5-;; |
| InChIKey | NTTVBSSOCBXTGS-MWKZNRQPSA-M |
| XLogP | -0.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide?
The IUPAC name of magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide (CID 163204937) is magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide.
What is the SMILES notation for magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide?
The canonical SMILES for magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide is [CH2-]C/C=C\CCOCOCCCCC.[I-].[Mg+2].
What is the InChIKey of magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide?
The InChIKey is NTTVBSSOCBXTGS-MWKZNRQPSA-M. The full InChI is InChI=1S/C12H23O2.HI.Mg/c1-3-5-7-9-11-14-12-13-10-8-6-4-2;;/h5,7H,1,3-4,6,8-12H2,2H3;1H;/q-1;;+2/p-1/b7-5-;;.
What are the key properties of magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide?
magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide has a molecular weight of 350.52 g/mol, XLogP of -0.04, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(Z)-1-(pentoxymethoxy)hex-3-ene;iodide is sourced from PubChem (CID 163204937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).