About (3Z)-7,7-diethoxyhepta-1,3-diene
(3Z)-7,7-diethoxyhepta-1,3-diene (PubChem CID 163205336) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is (3Z)-7,7-diethoxyhepta-1,3-diene.
Molecular Properties
| Compound Name | (3Z)-7,7-diethoxyhepta-1,3-diene |
| PubChem CID | 163205336 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (3Z)-7,7-diethoxyhepta-1,3-diene |
| SMILES | C=C/C=C\CCC(OCC)OCC |
| InChI | InChI=1S/C11H20O2/c1-4-7-8-9-10-11(12-5-2)13-6-3/h4,7-8,11H,1,5-6,9-10H2,2-3H3/b8-7- |
| InChIKey | OIWUZCFFHBCLNA-FPLPWBNLSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-7,7-diethoxyhepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-7,7-diethoxyhepta-1,3-diene?
The IUPAC name of (3Z)-7,7-diethoxyhepta-1,3-diene (CID 163205336) is (3Z)-7,7-diethoxyhepta-1,3-diene.
What is the SMILES notation for (3Z)-7,7-diethoxyhepta-1,3-diene?
The canonical SMILES for (3Z)-7,7-diethoxyhepta-1,3-diene is C=C/C=C\CCC(OCC)OCC.
What is the InChIKey of (3Z)-7,7-diethoxyhepta-1,3-diene?
The InChIKey is OIWUZCFFHBCLNA-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-7-8-9-10-11(12-5-2)13-6-3/h4,7-8,11H,1,5-6,9-10H2,2-3H3/b8-7-.
What are the key properties of (3Z)-7,7-diethoxyhepta-1,3-diene?
(3Z)-7,7-diethoxyhepta-1,3-diene has a molecular weight of 184.28 g/mol, XLogP of 2.91, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-7,7-diethoxyhepta-1,3-diene is sourced from PubChem (CID 163205336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).