About 3-amino-2-methoxybenzoic acid;hydrochloride
3-amino-2-methoxybenzoic acid;hydrochloride (PubChem CID 163206997) has the molecular formula C8H10ClNO3
and a molecular weight of 203.62 g/mol. Its IUPAC name is 3-amino-2-methoxybenzoic acid;hydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-methoxybenzoic acid;hydrochloride |
| PubChem CID | 163206997 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 3-amino-2-methoxybenzoic acid;hydrochloride |
| SMILES | COc1c(N)cccc1C(=O)O.Cl |
| InChI | InChI=1S/C8H9NO3.ClH/c1-12-7-5(8(10)11)3-2-4-6(7)9;/h2-4H,9H2,1H3,(H,10,11);1H |
| InChIKey | CXSZFBDSJDTECW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-methoxybenzoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-methoxybenzoic acid;hydrochloride?
The IUPAC name of 3-amino-2-methoxybenzoic acid;hydrochloride (CID 163206997) is 3-amino-2-methoxybenzoic acid;hydrochloride.
What is the SMILES notation for 3-amino-2-methoxybenzoic acid;hydrochloride?
The canonical SMILES for 3-amino-2-methoxybenzoic acid;hydrochloride is COc1c(N)cccc1C(=O)O.Cl.
What is the InChIKey of 3-amino-2-methoxybenzoic acid;hydrochloride?
The InChIKey is CXSZFBDSJDTECW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3.ClH/c1-12-7-5(8(10)11)3-2-4-6(7)9;/h2-4H,9H2,1H3,(H,10,11);1H.
What are the key properties of 3-amino-2-methoxybenzoic acid;hydrochloride?
3-amino-2-methoxybenzoic acid;hydrochloride has a molecular weight of 203.62 g/mol, XLogP of 1.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-methoxybenzoic acid;hydrochloride is sourced from PubChem (CID 163206997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).