C34H25FeN — CID 163207255
cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-1-(3-phenylnaphthalen-1-yl)indole;iron(2+) (PubChem CID 163207255) has the molecular formula C34H25FeN and a molecular weight of 503.43 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-1-(3-phenylnaphthalen-1-yl)indole;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-1-(3-phenylnaphthalen-1-yl)indole;iron(2+) |
|---|---|
| PubChem CID | 163207255 |
| Molecular Formula | C34H25FeN |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-yl-1-(3-phenylnaphthalen-1-yl)indole;iron(2+) |
| SMILES | [Fe+2].c1cc[cH-]c1.c1ccc(-c2cc(-n3c(-[c-]4cccc4)cc4ccccc43)c3ccccc3c2)cc1 |
| InChI | InChI=1S/C29H20N.C5H5.Fe/c1-2-10-21(11-3-1)25-18-23-14-6-8-16-26(23)29(20-25)30-27-17-9-7-15-24(27)19-28(30)22-12-4-5-13-22;1-2-4-5-3-1;/h1-20H;1-5H;/q2*-1;+2 |
| InChIKey | ZJPKCOJNGUZEKB-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|