C30H26Cl2F3N5O6S — CID 163208290
ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate (PubChem CID 163208290) has the molecular formula C30H26Cl2F3N5O6S and a molecular weight of 712.53 g/mol. Its IUPAC name is ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate.
| Compound Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
|---|---|
| PubChem CID | 163208290 |
| Molecular Formula | C30H26Cl2F3N5O6S |
| Molecular Weight | 712.53 g/mol |
| Exact Mass | 711.09 |
| IUPAC Name | ethyl N-[2-cyano-2-[[3,5-dichloro-4-[1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyphenyl]hydrazinylidene]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)=NNc1cc(Cl)c(Oc2ccc3c(c2)c(C(C)C(F)(F)F)cn3S(=O)(=O)C2(C)C=CC=CC2)c(Cl)c1 |
| InChI | InChI=1S/C30H26Cl2F3N5O6S/c1-4-45-28(42)37-27(41)24(15-36)39-38-18-12-22(31)26(23(32)13-18)46-19-8-9-25-20(14-19)21(17(2)30(33,34)35)16-40(25)47(43,44)29(3)10-6-5-7-11-29/h5-10,12-14,16-17,38H,4,11H2,1-3H3,(H,37,41,42) |
| InChIKey | AXPVZYOPYBFWSR-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.53 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|